C19H28N2O5 — CID 70314351
ethyl (1S,4R,6S,7Z)-2,15-dioxo-10-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 70314351) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl (1S,4R,6S,7Z)-2,15-dioxo-10-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | ethyl (1S,4R,6S,7Z)-2,15-dioxo-10-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 70314351 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | ethyl (1S,4R,6S,7Z)-2,15-dioxo-10-oxa-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@H]1/C=C\COCCCCC(=O)N1CCC[C@H]1C(=O)N2 |
| InChI | InChI=1S/C19H28N2O5/c1-2-26-18(24)19-13-14(19)7-6-12-25-11-4-3-9-16(22)21-10-5-8-15(21)17(23)20-19/h6-7,14-15H,2-5,8-13H2,1H3,(H,20,23)/b7-6-/t14-,15+,19-/m1/s1 |
| InChIKey | JPQAWPCMTPEVMQ-BBSUUPKLSA-N |
| XLogP | 1.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|