C14H21N5O — CID 176926438
4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-9-one (PubChem CID 176926438) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-9-one.
| Compound Name | 4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 176926438 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 4-methyl-6-propan-2-yl-1,3,5,8,13-pentazatricyclo[9.4.0.02,7]pentadeca-2,4,6-trien-9-one |
| SMILES | Cc1nc(C(C)C)c2c(n1)N1CCNCC1CC(=O)N2 |
| InChI | InChI=1S/C14H21N5O/c1-8(2)12-13-14(17-9(3)16-12)19-5-4-15-7-10(19)6-11(20)18-13/h8,10,15H,4-7H2,1-3H3,(H,18,20) |
| InChIKey | RGHXWCADFGYRON-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |