C11H21N3 — CID 176926920
4-methyl-3-propan-2-yl-2,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine (PubChem CID 176926920) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-methyl-3-propan-2-yl-2,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine.
| Compound Name | 4-methyl-3-propan-2-yl-2,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
|---|---|
| PubChem CID | 176926920 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 4-methyl-3-propan-2-yl-2,6,7,8,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazine |
| SMILES | CC1=C(C(C)C)NCC2CNCCN12 |
| InChI | InChI=1S/C11H21N3/c1-8(2)11-9(3)14-5-4-12-6-10(14)7-13-11/h8,10,12-13H,4-7H2,1-3H3 |
| InChIKey | XPZMNZPPBZCCAT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |