C19H28FN5S — CID 169255446
ethane;12-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene (PubChem CID 169255446) has the molecular formula C19H28FN5S and a molecular weight of 377.53 g/mol. Its IUPAC name is ethane;12-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene.
| Compound Name | ethane;12-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
|---|---|
| PubChem CID | 169255446 |
| Molecular Formula | C19H28FN5S |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | ethane;12-ethyl-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
| SMILES | CC.CCSc1nc2c3c(nc(CC)c(F)c3n1)CCC1CNCCN21 |
| InChI | InChI=1S/C17H22FN5S.C2H6/c1-3-11-14(18)15-13-12(20-11)6-5-10-9-19-7-8-23(10)16(13)22-17(21-15)24-4-2;1-2/h10,19H,3-9H2,1-2H3;1-2H3 |
| InChIKey | SEWNMEPEQVMCQJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |