C19H29BrF3N5OS — CID 169255693
azepan-3-ylmethanol;5-bromo-7-ethyl-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine;difluoromethane (PubChem CID 169255693) has the molecular formula C19H29BrF3N5OS and a molecular weight of 512.44 g/mol. Its IUPAC name is azepan-3-ylmethanol;5-bromo-7-ethyl-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine;difluoromethane.
| Compound Name | azepan-3-ylmethanol;5-bromo-7-ethyl-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine;difluoromethane |
|---|---|
| PubChem CID | 169255693 |
| Molecular Formula | C19H29BrF3N5OS |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | azepan-3-ylmethanol;5-bromo-7-ethyl-2-ethylsulfanyl-8-fluoropyrido[4,3-d]pyrimidin-4-amine;difluoromethane |
| SMILES | CCSc1nc(N)c2c(Br)nc(CC)c(F)c2n1.FCF.OCC1CCCCNC1 |
| InChI | InChI=1S/C11H12BrFN4S.C7H15NO.CH2F2/c1-3-5-7(13)8-6(9(12)15-5)10(14)17-11(16-8)18-4-2;9-6-7-3-1-2-4-8-5-7;2-1-3/h3-4H2,1-2H3,(H2,14,16,17);7-9H,1-6H2;1H2 |
| InChIKey | HLGXUZMVTZUDDK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|