C20H21N7O — CID 134277938
2-[[[2-[(1S,4S)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]amino]benzonitrile (PubChem CID 134277938) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-[[[2-[(1S,4S)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]amino]benzonitrile.
| Compound Name | 2-[[[2-[(1S,4S)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 134277938 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[[[2-[(1S,4S)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1NC(O)c1ccc2cnc(N3C[C@@H]4CC[C@H]3CN4)nn12 |
| InChI | InChI=1S/C20H21N7O/c21-9-13-3-1-2-4-17(13)24-19(28)18-8-7-16-11-23-20(25-27(16)18)26-12-14-5-6-15(26)10-22-14/h1-4,7-8,11,14-15,19,22,24,28H,5-6,10,12H2/t14-,15-,19?/m0/s1 |
| InChIKey | GRKAGMUCRLGUPJ-YIYRCGFGSA-N |
| XLogP | 1.64 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|