C17H19BrN8O — CID 122541820
N-(3-bromo-1-methylpyrazol-4-yl)-2-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 122541820) has the molecular formula C17H19BrN8O and a molecular weight of 431.30 g/mol. Its IUPAC name is N-(3-bromo-1-methylpyrazol-4-yl)-2-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | N-(3-bromo-1-methylpyrazol-4-yl)-2-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 122541820 |
| Molecular Formula | C17H19BrN8O |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-(3-bromo-1-methylpyrazol-4-yl)-2-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | Cn1cc(NC(=O)c2ccc3cnc(N4C[C@H]5CC[C@@H]4CN5)nn23)c(Br)n1 |
| InChI | InChI=1S/C17H19BrN8O/c1-24-9-13(15(18)22-24)21-16(27)14-5-4-12-7-20-17(23-26(12)14)25-8-10-2-3-11(25)6-19-10/h4-5,7,9-11,19H,2-3,6,8H2,1H3,(H,21,27)/t10-,11-/m1/s1 |
| InChIKey | YHIJYLCWPNVIBP-GHMZBOCLSA-N |
| XLogP | 1.42 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |