C19H18BrF3N6O3S — CID 134263702
N-(4-bromothiophen-3-yl)-2-(2,5-diazabicyclo[2.2.2]octan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 134263702) has the molecular formula C19H18BrF3N6O3S and a molecular weight of 547.36 g/mol. Its IUPAC name is N-(4-bromothiophen-3-yl)-2-(2,5-diazabicyclo[2.2.2]octan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(4-bromothiophen-3-yl)-2-(2,5-diazabicyclo[2.2.2]octan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134263702 |
| Molecular Formula | C19H18BrF3N6O3S |
| Molecular Weight | 547.36 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | N-(4-bromothiophen-3-yl)-2-(2,5-diazabicyclo[2.2.2]octan-2-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1cscc1Br)c1ccc2cnc(N3CC4CCC3CN4)nn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17BrN6OS.C2HF3O2/c18-13-8-26-9-14(13)21-16(25)15-4-3-12-6-20-17(22-24(12)15)23-7-10-1-2-11(23)5-19-10;3-2(4,5)1(6)7/h3-4,6,8-11,19H,1-2,5,7H2,(H,21,25);(H,6,7) |
| InChIKey | VVLUARMERWUNTN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |