C17H19BrF2N8O — CID 122541837
2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(3-bromo-1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 122541837) has the molecular formula C17H19BrF2N8O and a molecular weight of 469.29 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(3-bromo-1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(3-bromo-1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 122541837 |
| Molecular Formula | C17H19BrF2N8O |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(3-bromo-1-methylpyrazol-4-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | Cn1cc(NC(=O)c2ccc3cnc(N[C@@H]4CCCC(F)(F)[C@@H]4N)nn23)c(Br)n1 |
| InChI | InChI=1S/C17H19BrF2N8O/c1-27-8-11(14(18)25-27)23-15(29)12-5-4-9-7-22-16(26-28(9)12)24-10-3-2-6-17(19,20)13(10)21/h4-5,7-8,10,13H,2-3,6,21H2,1H3,(H,23,29)(H,24,26)/t10-,13-/m1/s1 |
| InChIKey | AWPFBQFOVUDWNE-ZWNOBZJWSA-N |
| XLogP | 2.40 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |