C20H19ClF5N5O3S — CID 134262231
2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-chlorothiophen-3-yl)pyrrolo[1,2-b]pyridazine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 134262231) has the molecular formula C20H19ClF5N5O3S and a molecular weight of 539.91 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-chlorothiophen-3-yl)pyrrolo[1,2-b]pyridazine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-chlorothiophen-3-yl)pyrrolo[1,2-b]pyridazine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134262231 |
| Molecular Formula | C20H19ClF5N5O3S |
| Molecular Weight | 539.91 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-chlorothiophen-3-yl)pyrrolo[1,2-b]pyridazine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | N[C@@H]1[C@H](Nc2ccc3ccc(C(=O)Nc4ccsc4Cl)n3n2)CCCC1(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H18ClF2N5OS.C2HF3O2/c19-16-12(7-9-28-16)24-17(27)13-5-3-10-4-6-14(25-26(10)13)23-11-2-1-8-18(20,21)15(11)22;3-2(4,5)1(6)7/h3-7,9,11,15H,1-2,8,22H2,(H,23,25)(H,24,27);(H,6,7)/t11-,15-;/m1./s1 |
| InChIKey | WNUWIVZATNVPLR-GPKQSYPGSA-N |
| XLogP | 4.86 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.91 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |