C17H17BrF2N6OS — CID 122541862
2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-bromothiophen-3-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 122541862) has the molecular formula C17H17BrF2N6OS and a molecular weight of 471.33 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-bromothiophen-3-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-bromothiophen-3-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 122541862 |
| Molecular Formula | C17H17BrF2N6OS |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 2-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-N-(2-bromothiophen-3-yl)pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | N[C@@H]1[C@H](Nc2ncc3ccc(C(=O)Nc4ccsc4Br)n3n2)CCCC1(F)F |
| InChI | InChI=1S/C17H17BrF2N6OS/c18-14-11(5-7-28-14)23-15(27)12-4-3-9-8-22-16(25-26(9)12)24-10-2-1-6-17(19,20)13(10)21/h3-5,7-8,10,13H,1-2,6,21H2,(H,23,27)(H,24,25)/t10-,13-/m1/s1 |
| InChIKey | MIUWRUYSXVRPFV-ZWNOBZJWSA-N |
| XLogP | 3.73 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |