C18H20F4N8O — CID 122196168
2-[[(1R,2S)-2-amino-5,5-difluorocyclohexyl]amino]-N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 122196168) has the molecular formula C18H20F4N8O and a molecular weight of 440.41 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-amino-5,5-difluorocyclohexyl]amino]-N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | 2-[[(1R,2S)-2-amino-5,5-difluorocyclohexyl]amino]-N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 122196168 |
| Molecular Formula | C18H20F4N8O |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[[(1R,2S)-2-amino-5,5-difluorocyclohexyl]amino]-N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | Cn1cc(NC(=O)c2ccc3cnc(N[C@@H]4CC(F)(F)CC[C@@H]4N)nn23)c(C(F)F)n1 |
| InChI | InChI=1S/C18H20F4N8O/c1-29-8-12(14(27-29)15(19)20)25-16(31)13-3-2-9-7-24-17(28-30(9)13)26-11-6-18(21,22)5-4-10(11)23/h2-3,7-8,10-11,15H,4-6,23H2,1H3,(H,25,31)(H,26,28)/t10-,11+/m0/s1 |
| InChIKey | ILCMELDGZVUPMY-WDEREUQCSA-N |
| XLogP | 2.58 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |