C22H23F5N6O3 — CID 134263755
2-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[2-(difluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 134263755) has the molecular formula C22H23F5N6O3 and a molecular weight of 514.46 g/mol. Its IUPAC name is 2-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[2-(difluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[2-(difluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 134263755 |
| Molecular Formula | C22H23F5N6O3 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 2-[[(1R,2S)-2-aminocyclohexyl]amino]-N-[2-(difluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | N[C@H]1CCCC[C@H]1Nc1ncc2ccc(C(=O)Nc3ccccc3C(F)F)n2n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H22F2N6O.C2HF3O2/c21-18(22)13-5-1-3-7-15(13)25-19(29)17-10-9-12-11-24-20(27-28(12)17)26-16-8-4-2-6-14(16)23;3-2(4,5)1(6)7/h1,3,5,7,9-11,14,16,18H,2,4,6,8,23H2,(H,25,29)(H,26,27);(H,6,7)/t14-,16+;/m0./s1 |
| InChIKey | WZGOONSIEVFJAO-KUARMEPBSA-N |
| XLogP | 4.23 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |