C20H19F5N6O — CID 140844620
N-[3-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-2-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide (PubChem CID 140844620) has the molecular formula C20H19F5N6O and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[3-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-2-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide.
| Compound Name | N-[3-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-2-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
|---|---|
| PubChem CID | 140844620 |
| Molecular Formula | C20H19F5N6O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[3-[[(1R,2R)-2-amino-3,3-difluorocyclohexyl]amino]-2-(trifluoromethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazine-7-carboxamide |
| SMILES | N[C@@H]1[C@H](Nc2cccc(NC(=O)c3ccc4cncnn34)c2C(F)(F)F)CCCC1(F)F |
| InChI | InChI=1S/C20H19F5N6O/c21-19(22)8-2-5-14(17(19)26)29-12-3-1-4-13(16(12)20(23,24)25)30-18(32)15-7-6-11-9-27-10-28-31(11)15/h1,3-4,6-7,9-10,14,17,29H,2,5,8,26H2,(H,30,32)/t14-,17-/m1/s1 |
| InChIKey | XAFPIXNUTZDHFC-RHSMWYFYSA-N |
| XLogP | 3.93 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |