C13H17N5O2 — CID 140844619
N'-[(1R,2S)-2-hydroxycyclohexyl]pyrrolo[2,1-f][1,2,4]triazine-7-carbohydrazide (PubChem CID 140844619) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is N'-[(1R,2S)-2-hydroxycyclohexyl]pyrrolo[2,1-f][1,2,4]triazine-7-carbohydrazide.
| Compound Name | N'-[(1R,2S)-2-hydroxycyclohexyl]pyrrolo[2,1-f][1,2,4]triazine-7-carbohydrazide |
|---|---|
| PubChem CID | 140844619 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N'-[(1R,2S)-2-hydroxycyclohexyl]pyrrolo[2,1-f][1,2,4]triazine-7-carbohydrazide |
| SMILES | O=C(NN[C@@H]1CCCC[C@@H]1O)c1ccc2cncnn12 |
| InChI | InChI=1S/C13H17N5O2/c19-12-4-2-1-3-10(12)16-17-13(20)11-6-5-9-7-14-8-15-18(9)11/h5-8,10,12,16,19H,1-4H2,(H,17,20)/t10-,12+/m1/s1 |
| InChIKey | OMPVEEGRNUIHGB-PWSUYJOCSA-N |
| XLogP | 0.27 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|