C21H15Cl3N4O2 — CID 134278752
2-chloro-N-[7-chloro-1-(6-chloropyridine-3-carbonyl)-3,4-dihydro-2H-1,8-naphthyridin-4-yl]benzamide (PubChem CID 134278752) has the molecular formula C21H15Cl3N4O2 and a molecular weight of 461.74 g/mol. Its IUPAC name is 2-chloro-N-[7-chloro-1-(6-chloropyridine-3-carbonyl)-3,4-dihydro-2H-1,8-naphthyridin-4-yl]benzamide.
| Compound Name | 2-chloro-N-[7-chloro-1-(6-chloropyridine-3-carbonyl)-3,4-dihydro-2H-1,8-naphthyridin-4-yl]benzamide |
|---|---|
| PubChem CID | 134278752 |
| Molecular Formula | C21H15Cl3N4O2 |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 2-chloro-N-[7-chloro-1-(6-chloropyridine-3-carbonyl)-3,4-dihydro-2H-1,8-naphthyridin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(Cl)nc2)c2nc(Cl)ccc21)c1ccccc1Cl |
| InChI | InChI=1S/C21H15Cl3N4O2/c22-15-4-2-1-3-13(15)20(29)26-16-9-10-28(19-14(16)6-8-18(24)27-19)21(30)12-5-7-17(23)25-11-12/h1-8,11,16H,9-10H2,(H,26,29) |
| InChIKey | MZMMXOLVQUBQAE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|