C15H20N2O — CID 134280560
2-[(3R,4S)-3-hydroxy-1-(1-phenylethyl)piperidin-4-yl]acetonitrile (PubChem CID 134280560) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[(3R,4S)-3-hydroxy-1-(1-phenylethyl)piperidin-4-yl]acetonitrile.
| Compound Name | 2-[(3R,4S)-3-hydroxy-1-(1-phenylethyl)piperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 134280560 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 2-[(3R,4S)-3-hydroxy-1-(1-phenylethyl)piperidin-4-yl]acetonitrile |
| SMILES | CC(c1ccccc1)N1CC[C@@H](CC#N)[C@@H](O)C1 |
| InChI | InChI=1S/C15H20N2O/c1-12(13-5-3-2-4-6-13)17-10-8-14(7-9-16)15(18)11-17/h2-6,12,14-15,18H,7-8,10-11H2,1H3/t12?,14-,15+/m1/s1 |
| InChIKey | UZCHBRJQALPIQU-UCWKZMIHSA-N |
| XLogP | 2.34 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |