C14H24O3 — CID 13428092
(1R,2S)-2-methyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]but-3-en-1-ol (PubChem CID 13428092) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1R,2S)-2-methyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]but-3-en-1-ol.
| Compound Name | (1R,2S)-2-methyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 13428092 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1R,2S)-2-methyl-1-[(2R,3R)-2-methyl-1,4-dioxaspiro[4.5]decan-3-yl]but-3-en-1-ol |
| SMILES | C=C[C@H](C)[C@@H](O)[C@H]1OC2(CCCCC2)O[C@@H]1C |
| InChI | InChI=1S/C14H24O3/c1-4-10(2)12(15)13-11(3)16-14(17-13)8-6-5-7-9-14/h4,10-13,15H,1,5-9H2,2-3H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | AWQNPZZGXWNJFA-LOWDOPEQSA-N |
| XLogP | 2.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|