C13H18F4O3 — CID 165415791
(1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol (PubChem CID 165415791) has the molecular formula C13H18F4O3 and a molecular weight of 298.28 g/mol. Its IUPAC name is (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol.
| Compound Name | (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 165415791 |
| Molecular Formula | C13H18F4O3 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R,2S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-fluoro-2-(trifluoromethyl)but-3-en-1-ol |
| SMILES | C=C[C@](F)([C@H](O)[C@H]1COC2(CCCCC2)O1)C(F)(F)F |
| InChI | InChI=1S/C13H18F4O3/c1-2-12(14,13(15,16)17)10(18)9-8-19-11(20-9)6-4-3-5-7-11/h2,9-10,18H,1,3-8H2/t9-,10-,12+/m1/s1 |
| InChIKey | KTORSLLRKWEHIM-FOGDFJRCSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|