C14H24O3 — CID 165415772
(1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethylbut-3-en-1-ol (PubChem CID 165415772) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethylbut-3-en-1-ol.
| Compound Name | (1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethylbut-3-en-1-ol |
|---|---|
| PubChem CID | 165415772 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethylbut-3-en-1-ol |
| SMILES | C=CC(C)(C)[C@H](O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C14H24O3/c1-4-13(2,3)12(15)11-10-16-14(17-11)8-6-5-7-9-14/h4,11-12,15H,1,5-10H2,2-3H3/t11-,12-/m1/s1 |
| InChIKey | DHFQVLNBGUCZAX-VXGBXAGGSA-N |
| XLogP | 2.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|