C10H15F3O3 — CID 11708528
(1S,2S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-en-1-ol (PubChem CID 11708528) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is (1S,2S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-en-1-ol.
| Compound Name | (1S,2S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 11708528 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1S,2S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-en-1-ol |
| SMILES | C=C[C@@H]([C@H](O)[C@H]1COC(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O3/c1-4-6(10(11,12)13)8(14)7-5-15-9(2,3)16-7/h4,6-8,14H,1,5H2,2-3H3/t6-,7+,8-/m0/s1 |
| InChIKey | OGPLJYKNFDQHGC-RNJXMRFFSA-N |
| XLogP | 1.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|