C23H22ClF4N7O3S — CID 134281549
[(1R,3R)-5-amino-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 134281549) has the molecular formula C23H22ClF4N7O3S and a molecular weight of 587.99 g/mol. Its IUPAC name is [(1R,3R)-5-amino-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,3R)-5-amino-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134281549 |
| Molecular Formula | C23H22ClF4N7O3S |
| Molecular Weight | 587.99 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | [(1R,3R)-5-amino-3-[5-[1-(5-chloro-2-pyridinyl)triazol-4-yl]-2-fluorophenyl]-3,6,6-trimethyl-1-methylimino-1-oxo-2H-1,4-thiazin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CN=[S@]1(=O)C(OC(=O)C(F)(F)F)[C@@](C)(c2cc(-c3cn(-c4ccc(Cl)cn4)nn3)ccc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C23H22ClF4N7O3S/c1-21(2)18(29)32-22(3,20(39(21,37)30-4)38-19(36)23(26,27)28)14-9-12(5-7-15(14)25)16-11-35(34-33-16)17-8-6-13(24)10-31-17/h5-11,20H,1-4H3,(H2,29,32)/t20?,22-,39+/m1/s1 |
| InChIKey | NIVYZBPGLHOQKK-XIEDIWMGSA-N |
| XLogP | 4.02 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |