C14H9Cl2F2NO3 — CID 134284467
3-[2-chloro-6-(difluoromethoxy)phenyl]-5-cyclopropyl-1,2-oxazole-4-carbonyl chloride (PubChem CID 134284467) has the molecular formula C14H9Cl2F2NO3 and a molecular weight of 348.13 g/mol. Its IUPAC name is 3-[2-chloro-6-(difluoromethoxy)phenyl]-5-cyclopropyl-1,2-oxazole-4-carbonyl chloride.
| Compound Name | 3-[2-chloro-6-(difluoromethoxy)phenyl]-5-cyclopropyl-1,2-oxazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 134284467 |
| Molecular Formula | C14H9Cl2F2NO3 |
| Molecular Weight | 348.13 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 3-[2-chloro-6-(difluoromethoxy)phenyl]-5-cyclopropyl-1,2-oxazole-4-carbonyl chloride |
| SMILES | O=C(Cl)c1c(-c2c(Cl)cccc2OC(F)F)noc1C1CC1 |
| InChI | InChI=1S/C14H9Cl2F2NO3/c15-7-2-1-3-8(21-14(17)18)9(7)11-10(13(16)20)12(22-19-11)6-4-5-6/h1-3,6,14H,4-5H2 |
| InChIKey | WXOOMRWBZUWDJK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.13 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|