C13H9ClFNO2 — CID 164823176
3-(2-chloro-6-fluorophenyl)-5-cyclopropyl-1,2-oxazole-4-carbaldehyde (PubChem CID 164823176) has the molecular formula C13H9ClFNO2 and a molecular weight of 265.67 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-5-cyclopropyl-1,2-oxazole-4-carbaldehyde.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-5-cyclopropyl-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 164823176 |
| Molecular Formula | C13H9ClFNO2 |
| Molecular Weight | 265.67 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-5-cyclopropyl-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1c(-c2c(F)cccc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C13H9ClFNO2/c14-9-2-1-3-10(15)11(9)12-8(6-17)13(18-16-12)7-4-5-7/h1-3,6-7H,4-5H2 |
| InChIKey | GAIQUJDJBKPLBN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|