C13H10BrF2NO — CID 155223675
4-(bromomethyl)-5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazole (PubChem CID 155223675) has the molecular formula C13H10BrF2NO and a molecular weight of 314.13 g/mol. Its IUPAC name is 4-(bromomethyl)-5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazole.
| Compound Name | 4-(bromomethyl)-5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 155223675 |
| Molecular Formula | C13H10BrF2NO |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 4-(bromomethyl)-5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazole |
| SMILES | Fc1cccc(F)c1-c1noc(C2CC2)c1CBr |
| InChI | InChI=1S/C13H10BrF2NO/c14-6-8-12(17-18-13(8)7-4-5-7)11-9(15)2-1-3-10(11)16/h1-3,7H,4-6H2 |
| InChIKey | RKWCMNAAVYZUCR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|