About 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one
5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one (PubChem CID 135894584) has the molecular formula C12H9BrCl2N2O2
and a molecular weight of 364.03 g/mol. Its IUPAC name is 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one |
| PubChem CID | 135894584 |
| Molecular Formula | C12H9BrCl2N2O2 |
| Molecular Weight | 364.03 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one |
| SMILES | O=c1cc(Cl)c(-c2noc(C3CC3)c2CBr)c(Cl)[nH]1 |
| InChI | InChI=1S/C12H9BrCl2N2O2/c13-4-6-10(17-19-11(6)5-1-2-5)9-7(14)3-8(18)16-12(9)15/h3,5H,1-2,4H2,(H,16,18) |
| InChIKey | IDJRDKPWPUUVLL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.03 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one?
The IUPAC name of 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one (CID 135894584) is 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one.
What is the SMILES notation for 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one?
The canonical SMILES for 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one is O=c1cc(Cl)c(-c2noc(C3CC3)c2CBr)c(Cl)[nH]1.
What is the InChIKey of 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one?
The InChIKey is IDJRDKPWPUUVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrCl2N2O2/c13-4-6-10(17-19-11(6)5-1-2-5)9-7(14)3-8(18)16-12(9)15/h3,5H,1-2,4H2,(H,16,18).
What are the key properties of 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one?
5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one has a molecular weight of 364.03 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(bromomethyl)-5-cyclopropyl-1,2-oxazol-3-yl]-4,6-dichloro-1H-pyridin-2-one is sourced from PubChem (CID 135894584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).