C18H22Cl2N2O3 — CID 138602342
6-[[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methoxy]hexan-1-ol (PubChem CID 138602342) has the molecular formula C18H22Cl2N2O3 and a molecular weight of 385.29 g/mol. Its IUPAC name is 6-[[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methoxy]hexan-1-ol.
| Compound Name | 6-[[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methoxy]hexan-1-ol |
|---|---|
| PubChem CID | 138602342 |
| Molecular Formula | C18H22Cl2N2O3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 6-[[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methoxy]hexan-1-ol |
| SMILES | OCCCCCCOCc1c(-c2c(Cl)cncc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C18H22Cl2N2O3/c19-14-9-21-10-15(20)16(14)17-13(18(25-22-17)12-5-6-12)11-24-8-4-2-1-3-7-23/h9-10,12,23H,1-8,11H2 |
| InChIKey | NJQDHJBKEWTIQD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|