C18H20Cl2N2O2 — CID 138602564
(E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-en-1-ol (PubChem CID 138602564) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is (E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-en-1-ol.
| Compound Name | (E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-en-1-ol |
|---|---|
| PubChem CID | 138602564 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-en-1-ol |
| SMILES | OCCCCC/C=C/c1c(-c2c(Cl)cncc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c19-14-10-21-11-15(20)16(14)17-13(6-4-2-1-3-5-9-23)18(24-22-17)12-7-8-12/h4,6,10-12,23H,1-3,5,7-9H2/b6-4+ |
| InChIKey | JPYRXJMDUOSOHM-GQCTYLIASA-N |
| XLogP | 5.49 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|