C20H22Cl2N2O3 — CID 142582133
(E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-enoic acid;ethene (PubChem CID 142582133) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is (E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-enoic acid;ethene.
| Compound Name | (E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-enoic acid;ethene |
|---|---|
| PubChem CID | 142582133 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (E)-7-[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]hept-6-enoic acid;ethene |
| SMILES | C=C.O=C(O)CCCC/C=C/c1c(-c2c(Cl)cncc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C18H18Cl2N2O3.C2H4/c19-13-9-21-10-14(20)16(13)17-12(18(25-22-17)11-7-8-11)5-3-1-2-4-6-15(23)24;1-2/h3,5,9-11H,1-2,4,6-8H2,(H,23,24);1-2H2/b5-3+; |
| InChIKey | IKRNGNGKFDJMJU-WGCWOXMQSA-N |
| XLogP | 6.38 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|