C12H11Cl2N2O4P — CID 138584982
[5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methylphosphonic acid (PubChem CID 138584982) has the molecular formula C12H11Cl2N2O4P and a molecular weight of 349.11 g/mol. Its IUPAC name is [5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methylphosphonic acid.
| Compound Name | [5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 138584982 |
| Molecular Formula | C12H11Cl2N2O4P |
| Molecular Weight | 349.11 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | [5-cyclopropyl-3-(3,5-dichloro-4-pyridinyl)-1,2-oxazol-4-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1c(-c2c(Cl)cncc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C12H11Cl2N2O4P/c13-8-3-15-4-9(14)10(8)11-7(5-21(17,18)19)12(20-16-11)6-1-2-6/h3-4,6H,1-2,5H2,(H2,17,18,19) |
| InChIKey | HWVHXXUVWFUVGE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|