C24H21Cl2NO4 — CID 138602243
4-[[(E)-4-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]but-3-enoxy]methyl]benzoic acid (PubChem CID 138602243) has the molecular formula C24H21Cl2NO4 and a molecular weight of 458.34 g/mol. Its IUPAC name is 4-[[(E)-4-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]but-3-enoxy]methyl]benzoic acid.
| Compound Name | 4-[[(E)-4-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]but-3-enoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 138602243 |
| Molecular Formula | C24H21Cl2NO4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 4-[[(E)-4-[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]but-3-enoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COCC/C=C/c2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cc1 |
| InChI | InChI=1S/C24H21Cl2NO4/c25-19-5-3-6-20(26)21(19)22-18(23(31-27-22)16-11-12-16)4-1-2-13-30-14-15-7-9-17(10-8-15)24(28)29/h1,3-10,16H,2,11-14H2,(H,28,29)/b4-1+ |
| InChIKey | RTDXIMRAXYFBFY-DAFODLJHSA-N |
| XLogP | 6.84 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|