C21H13Cl4NO2 — CID 146473353
5-cyclopropyl-4-[(2,5-dichloro-4-ethynylphenoxy)methyl]-3-(2,6-dichlorophenyl)-1,2-oxazole (PubChem CID 146473353) has the molecular formula C21H13Cl4NO2 and a molecular weight of 453.15 g/mol. Its IUPAC name is 5-cyclopropyl-4-[(2,5-dichloro-4-ethynylphenoxy)methyl]-3-(2,6-dichlorophenyl)-1,2-oxazole.
| Compound Name | 5-cyclopropyl-4-[(2,5-dichloro-4-ethynylphenoxy)methyl]-3-(2,6-dichlorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 146473353 |
| Molecular Formula | C21H13Cl4NO2 |
| Molecular Weight | 453.15 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | 5-cyclopropyl-4-[(2,5-dichloro-4-ethynylphenoxy)methyl]-3-(2,6-dichlorophenyl)-1,2-oxazole |
| SMILES | C#Cc1cc(Cl)c(OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cc1Cl |
| InChI | InChI=1S/C21H13Cl4NO2/c1-2-11-8-17(25)18(9-16(11)24)27-10-13-20(26-28-21(13)12-6-7-12)19-14(22)4-3-5-15(19)23/h1,3-5,8-9,12H,6-7,10H2 |
| InChIKey | AUWBQZQKGIKASG-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.15 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|