C27H17Cl3N2O4 — CID 146473096
4-[[3-chloro-4-[2-(3-nitrophenyl)ethynyl]phenoxy]methyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole (PubChem CID 146473096) has the molecular formula C27H17Cl3N2O4 and a molecular weight of 539.80 g/mol. Its IUPAC name is 4-[[3-chloro-4-[2-(3-nitrophenyl)ethynyl]phenoxy]methyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole.
| Compound Name | 4-[[3-chloro-4-[2-(3-nitrophenyl)ethynyl]phenoxy]methyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 146473096 |
| Molecular Formula | C27H17Cl3N2O4 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | 4-[[3-chloro-4-[2-(3-nitrophenyl)ethynyl]phenoxy]methyl]-5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole |
| SMILES | O=[N+]([O-])c1cccc(C#Cc2ccc(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)cc2Cl)c1 |
| InChI | InChI=1S/C27H17Cl3N2O4/c28-22-5-2-6-23(29)25(22)26-21(27(36-31-26)18-9-10-18)15-35-20-12-11-17(24(30)14-20)8-7-16-3-1-4-19(13-16)32(33)34/h1-6,11-14,18H,9-10,15H2 |
| InChIKey | BDHBOUPVMOZTPK-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 78.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|