C30H21Cl3N2O6 — CID 146473288
methyl 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]ethynyl]-4-methyl-5-nitrobenzoate (PubChem CID 146473288) has the molecular formula C30H21Cl3N2O6 and a molecular weight of 611.87 g/mol. Its IUPAC name is methyl 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]ethynyl]-4-methyl-5-nitrobenzoate.
| Compound Name | methyl 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]ethynyl]-4-methyl-5-nitrobenzoate |
|---|---|
| PubChem CID | 146473288 |
| Molecular Formula | C30H21Cl3N2O6 |
| Molecular Weight | 611.87 g/mol |
| Exact Mass | 610.05 |
| IUPAC Name | methyl 3-[2-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]ethynyl]-4-methyl-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C#Cc2ccc(OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)cc2Cl)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H21Cl3N2O6/c1-16-19(12-20(30(36)39-2)13-26(16)35(37)38)9-6-17-10-11-21(14-25(17)33)40-15-22-28(34-41-29(22)18-7-8-18)27-23(31)4-3-5-24(27)32/h3-5,10-14,18H,7-8,15H2,1-2H3 |
| InChIKey | IYPGTGNDVSYKFU-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.87 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|