C19H12Cl2F3N3O4 — CID 68983966
5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[5-nitro-6-(trifluoromethyl)-2-pyridinyl]oxymethyl]-1,2-oxazole (PubChem CID 68983966) has the molecular formula C19H12Cl2F3N3O4 and a molecular weight of 474.22 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[5-nitro-6-(trifluoromethyl)-2-pyridinyl]oxymethyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[5-nitro-6-(trifluoromethyl)-2-pyridinyl]oxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 68983966 |
| Molecular Formula | C19H12Cl2F3N3O4 |
| Molecular Weight | 474.22 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[5-nitro-6-(trifluoromethyl)-2-pyridinyl]oxymethyl]-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccc(OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C19H12Cl2F3N3O4/c20-11-2-1-3-12(21)15(11)16-10(17(31-26-16)9-4-5-9)8-30-14-7-6-13(27(28)29)18(25-14)19(22,23)24/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | NDEWFFKYUSSVOU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.22 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|