C21H14Cl2N2O4 — CID 163217211
2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]isoindole-1,3-dione (PubChem CID 163217211) has the molecular formula C21H14Cl2N2O4 and a molecular weight of 429.26 g/mol. Its IUPAC name is 2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 163217211 |
| Molecular Formula | C21H14Cl2N2O4 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCc1c(-c2c(Cl)cccc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C21H14Cl2N2O4/c22-15-6-3-7-16(23)17(15)18-14(19(29-24-18)11-8-9-11)10-28-25-20(26)12-4-1-2-5-13(12)21(25)27/h1-7,11H,8-10H2 |
| InChIKey | JTKDQCGXLRIHBC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|