C28H27BCl2N2O4 — CID 174001200
5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxymethyl]-1,2-oxazole (PubChem CID 174001200) has the molecular formula C28H27BCl2N2O4 and a molecular weight of 537.25 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxymethyl]-1,2-oxazole.
| Compound Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 174001200 |
| Molecular Formula | C28H27BCl2N2O4 |
| Molecular Weight | 537.25 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 5-cyclopropyl-3-(2,6-dichlorophenyl)-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-3-yl]oxymethyl]-1,2-oxazole |
| SMILES | CC1(C)OB(c2ccc3cc(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)cnc3c2)OC1(C)C |
| InChI | InChI=1S/C28H27BCl2N2O4/c1-27(2)28(3,4)37-29(36-27)18-11-10-17-12-19(14-32-23(17)13-18)34-15-20-25(33-35-26(20)16-8-9-16)24-21(30)6-5-7-22(24)31/h5-7,10-14,16H,8-9,15H2,1-4H3 |
| InChIKey | VEIIKCSAMYBRJZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.25 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|