C29H27Cl2N3O4 — CID 134284707
3-[3-cyano-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]propanoic acid (PubChem CID 134284707) has the molecular formula C29H27Cl2N3O4 and a molecular weight of 552.46 g/mol. Its IUPAC name is 3-[3-cyano-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[3-cyano-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 134284707 |
| Molecular Formula | C29H27Cl2N3O4 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 3-[3-cyano-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]propanoic acid |
| SMILES | N#Cc1cc(CCC(=O)O)ccc1N1C[C@@H]2C[C@H]1C[C@H]2OCc1c(-c2c(Cl)cccc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C29H27Cl2N3O4/c30-22-2-1-3-23(31)27(22)28-21(29(38-33-28)17-6-7-17)15-37-25-12-20-11-19(25)14-34(20)24-8-4-16(5-9-26(35)36)10-18(24)13-32/h1-4,8,10,17,19-20,25H,5-7,9,11-12,14-15H2,(H,35,36)/t19-,20-,25+/m0/s1 |
| InChIKey | GIMZJJQTKTVJET-ZYLNGJIFSA-N |
| XLogP | 6.60 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |