C29H29Cl2FN2O4 — CID 139345357
3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]butanoic acid (PubChem CID 139345357) has the molecular formula C29H29Cl2FN2O4 and a molecular weight of 559.47 g/mol. Its IUPAC name is 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]butanoic acid.
| Compound Name | 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]butanoic acid |
|---|---|
| PubChem CID | 139345357 |
| Molecular Formula | C29H29Cl2FN2O4 |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(N2C[C@@H]3C[C@H]2C[C@H]3OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)c(F)c1 |
| InChI | InChI=1S/C29H29Cl2FN2O4/c1-15(9-26(35)36)17-7-8-24(23(32)11-17)34-13-18-10-19(34)12-25(18)37-14-20-28(33-38-29(20)16-5-6-16)27-21(30)3-2-4-22(27)31/h2-4,7-8,11,15-16,18-19,25H,5-6,9-10,12-14H2,1H3,(H,35,36)/t15?,18-,19-,25+/m0/s1 |
| InChIKey | PQRWUPZZRZQHOT-OYSHIGHVSA-N |
| XLogP | 7.43 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |