C38H47Cl2FN4O6S — CID 139345663
N-(10-acetamidodecylsulfonyl)-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorobenzamide (PubChem CID 139345663) has the molecular formula C38H47Cl2FN4O6S and a molecular weight of 777.79 g/mol. Its IUPAC name is N-(10-acetamidodecylsulfonyl)-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorobenzamide.
| Compound Name | N-(10-acetamidodecylsulfonyl)-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 139345663 |
| Molecular Formula | C38H47Cl2FN4O6S |
| Molecular Weight | 777.79 g/mol |
| Exact Mass | 776.26 |
| IUPAC Name | N-(10-acetamidodecylsulfonyl)-4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-3-fluorobenzamide |
| SMILES | CC(=O)NCCCCCCCCCCS(=O)(=O)NC(=O)c1ccc(N2C[C@@H]3C[C@H]2C[C@H]3OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)c(F)c1 |
| InChI | InChI=1S/C38H47Cl2FN4O6S/c1-24(46)42-17-8-6-4-2-3-5-7-9-18-52(48,49)44-38(47)26-15-16-33(32(41)20-26)45-22-27-19-28(45)21-34(27)50-23-29-36(43-51-37(29)25-13-14-25)35-30(39)11-10-12-31(35)40/h10-12,15-16,20,25,27-28,34H,2-9,13-14,17-19,21-23H2,1H3,(H,42,46)(H,44,47)/t27-,28-,34+/m0/s1 |
| InChIKey | VAXGJHYHJOLIIL-ITAFUGMPSA-N |
| XLogP | 8.17 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.79 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|