C18H21N5O8 — CID 134285721
2-[bis[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid (PubChem CID 134285721) has the molecular formula C18H21N5O8 and a molecular weight of 435.39 g/mol. Its IUPAC name is 2-[bis[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 134285721 |
| Molecular Formula | C18H21N5O8 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[bis[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)NCCN1C(=O)C=CC1=O)CC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H21N5O8/c24-12(19-5-7-22-14(26)1-2-15(22)27)9-21(11-18(30)31)10-13(25)20-6-8-23-16(28)3-4-17(23)29/h1-4H,5-11H2,(H,19,24)(H,20,25)(H,30,31) |
| InChIKey | QGHLQVSGOWLFDN-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|