C9H14N2 — CID 134286364
(1Z)-N-methyl-1-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine (PubChem CID 134286364) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (1Z)-N-methyl-1-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine.
| Compound Name | (1Z)-N-methyl-1-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 134286364 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (1Z)-N-methyl-1-(methylideneamino)-N-[(Z)-prop-1-enyl]buta-1,3-dien-2-amine |
| SMILES | C=C/C(=C/N=C)N(C)/C=C\C |
| InChI | InChI=1S/C9H14N2/c1-5-7-11(4)9(6-2)8-10-3/h5-8H,2-3H2,1,4H3/b7-5-,9-8- |
| InChIKey | HIEYATYIIOEHGU-PJHABFGRSA-N |
| XLogP | 2.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|