C26H26ClN5O — CID 134286975
1'-[(5-chloro-1-hept-6-en-4-ynylbenzimidazol-2-yl)methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one (PubChem CID 134286975) has the molecular formula C26H26ClN5O and a molecular weight of 459.98 g/mol. Its IUPAC name is 1'-[(5-chloro-1-hept-6-en-4-ynylbenzimidazol-2-yl)methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one.
| Compound Name | 1'-[(5-chloro-1-hept-6-en-4-ynylbenzimidazol-2-yl)methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one |
|---|---|
| PubChem CID | 134286975 |
| Molecular Formula | C26H26ClN5O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 1'-[(5-chloro-1-hept-6-en-4-ynylbenzimidazol-2-yl)methyl]spiro[piperidine-4,3'-pyrrolo[2,3-c]pyridine]-2'-one |
| SMILES | C=CC#CCCCn1c(CN2C(=O)C3(CCNCC3)c3ccncc32)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H26ClN5O/c1-2-3-4-5-6-15-31-22-8-7-19(27)16-21(22)30-24(31)18-32-23-17-29-12-9-20(23)26(25(32)33)10-13-28-14-11-26/h2,7-9,12,16-17,28H,1,5-6,10-11,13-15,18H2 |
| InChIKey | MTWJAIIANPUTOK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|