C44H42Cl2N12O2 — CID 161140779
4-[2-[(3-amino-2'-oxospiro[cyclobutane-1,3'-pyrrolo[2,3-c]pyridine]-1'-yl)methyl]-5-chlorobenzimidazol-1-yl]butanenitrile (PubChem CID 161140779) has the molecular formula C44H42Cl2N12O2 and a molecular weight of 841.81 g/mol. Its IUPAC name is 4-[2-[(3-amino-2'-oxospiro[cyclobutane-1,3'-pyrrolo[2,3-c]pyridine]-1'-yl)methyl]-5-chlorobenzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-[(3-amino-2'-oxospiro[cyclobutane-1,3'-pyrrolo[2,3-c]pyridine]-1'-yl)methyl]-5-chlorobenzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 161140779 |
| Molecular Formula | C44H42Cl2N12O2 |
| Molecular Weight | 841.81 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | 4-[2-[(3-amino-2'-oxospiro[cyclobutane-1,3'-pyrrolo[2,3-c]pyridine]-1'-yl)methyl]-5-chlorobenzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(CN2C(=O)C3(CC(N)C3)c3ccncc32)nc2cc(Cl)ccc21.N#CCCCn1c(CN2C(=O)C3(CC(N)C3)c3ccncc32)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/2C22H21ClN6O/c2*23-14-3-4-18-17(9-14)27-20(28(18)8-2-1-6-24)13-29-19-12-26-7-5-16(19)22(21(29)30)10-15(25)11-22/h2*3-5,7,9,12,15H,1-2,8,10-11,13,25H2 |
| InChIKey | UNKKNSZGARUOLA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 201.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|