C15H28N2O — CID 134288485
(1E,3E)-4-methyl-1-propan-2-yloxy-7-pyrrolidin-1-ylhepta-1,3-dien-1-amine (PubChem CID 134288485) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (1E,3E)-4-methyl-1-propan-2-yloxy-7-pyrrolidin-1-ylhepta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-4-methyl-1-propan-2-yloxy-7-pyrrolidin-1-ylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134288485 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (1E,3E)-4-methyl-1-propan-2-yloxy-7-pyrrolidin-1-ylhepta-1,3-dien-1-amine |
| SMILES | C/C(=C\C=C(/N)OC(C)C)CCCN1CCCC1 |
| InChI | InChI=1S/C15H28N2O/c1-13(2)18-15(16)9-8-14(3)7-6-12-17-10-4-5-11-17/h8-9,13H,4-7,10-12,16H2,1-3H3/b14-8+,15-9+ |
| InChIKey | DXXOHWFSMUSEBB-VOMDNODZSA-N |
| XLogP | 3.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|