C14H23F3N2O — CID 134288594
(1E,3E)-4-methyl-7-pyrrolidin-1-yl-1-(2,2,2-trifluoroethoxy)hepta-1,3-dien-1-amine (PubChem CID 134288594) has the molecular formula C14H23F3N2O and a molecular weight of 292.35 g/mol. Its IUPAC name is (1E,3E)-4-methyl-7-pyrrolidin-1-yl-1-(2,2,2-trifluoroethoxy)hepta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-4-methyl-7-pyrrolidin-1-yl-1-(2,2,2-trifluoroethoxy)hepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134288594 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (1E,3E)-4-methyl-7-pyrrolidin-1-yl-1-(2,2,2-trifluoroethoxy)hepta-1,3-dien-1-amine |
| SMILES | C/C(=C\C=C(/N)OCC(F)(F)F)CCCN1CCCC1 |
| InChI | InChI=1S/C14H23F3N2O/c1-12(5-4-10-19-8-2-3-9-19)6-7-13(18)20-11-14(15,16)17/h6-7H,2-5,8-11,18H2,1H3/b12-6+,13-7+ |
| InChIKey | XZDWWQIJEPBNFJ-PWHKKFIBSA-N |
| XLogP | 3.19 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|