C26H27F3N6O — CID 134288566
6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-pyrimidin-5-yl-N-[4-(3,3,3-trifluoropropyl)phenyl]pyridine-3-carboxamide (PubChem CID 134288566) has the molecular formula C26H27F3N6O and a molecular weight of 496.54 g/mol. Its IUPAC name is 6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-pyrimidin-5-yl-N-[4-(3,3,3-trifluoropropyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-pyrimidin-5-yl-N-[4-(3,3,3-trifluoropropyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134288566 |
| Molecular Formula | C26H27F3N6O |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 6-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-5-pyrimidin-5-yl-N-[4-(3,3,3-trifluoropropyl)phenyl]pyridine-3-carboxamide |
| SMILES | CN1CC2CN(c3ncc(C(=O)Nc4ccc(CCC(F)(F)F)cc4)cc3-c3cncnc3)CC2C1 |
| InChI | InChI=1S/C26H27F3N6O/c1-34-12-20-14-35(15-21(20)13-34)24-23(19-9-30-16-31-10-19)8-18(11-32-24)25(36)33-22-4-2-17(3-5-22)6-7-26(27,28)29/h2-5,8-11,16,20-21H,6-7,12-15H2,1H3,(H,33,36) |
| InChIKey | VQOUNAOUEAIZHE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |