C20H20FN3O3 — CID 134290194
1-benzyl-2-(4,5-dimethoxy-2-methylanilino)-5-fluoropyrimidin-4-one (PubChem CID 134290194) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 1-benzyl-2-(4,5-dimethoxy-2-methylanilino)-5-fluoropyrimidin-4-one.
| Compound Name | 1-benzyl-2-(4,5-dimethoxy-2-methylanilino)-5-fluoropyrimidin-4-one |
|---|---|
| PubChem CID | 134290194 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-benzyl-2-(4,5-dimethoxy-2-methylanilino)-5-fluoropyrimidin-4-one |
| SMILES | COc1cc(C)c(Nc2nc(=O)c(F)cn2Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H20FN3O3/c1-13-9-17(26-2)18(27-3)10-16(13)22-20-23-19(25)15(21)12-24(20)11-14-7-5-4-6-8-14/h4-10,12H,11H2,1-3H3,(H,22,23,25) |
| InChIKey | RGNKZEXTYPYDSH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |