C20H19Cl2N3O2 — CID 134290957
2-(5-chloro-2-ethylanilino)-1-[(3-chlorophenyl)methyl]-5-methoxypyrimidin-4-one (PubChem CID 134290957) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 2-(5-chloro-2-ethylanilino)-1-[(3-chlorophenyl)methyl]-5-methoxypyrimidin-4-one.
| Compound Name | 2-(5-chloro-2-ethylanilino)-1-[(3-chlorophenyl)methyl]-5-methoxypyrimidin-4-one |
|---|---|
| PubChem CID | 134290957 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 2-(5-chloro-2-ethylanilino)-1-[(3-chlorophenyl)methyl]-5-methoxypyrimidin-4-one |
| SMILES | CCc1ccc(Cl)cc1Nc1nc(=O)c(OC)cn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-3-14-7-8-16(22)10-17(14)23-20-24-19(26)18(27-2)12-25(20)11-13-5-4-6-15(21)9-13/h4-10,12H,3,11H2,1-2H3,(H,23,24,26) |
| InChIKey | DOMNESBLHSQZHF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |