C19H14ClF4N3O — CID 134291467
2-(5-chloro-2-ethylanilino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one (PubChem CID 134291467) has the molecular formula C19H14ClF4N3O and a molecular weight of 411.79 g/mol. Its IUPAC name is 2-(5-chloro-2-ethylanilino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one.
| Compound Name | 2-(5-chloro-2-ethylanilino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 134291467 |
| Molecular Formula | C19H14ClF4N3O |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 2-(5-chloro-2-ethylanilino)-5-fluoro-1-[(3,4,5-trifluorophenyl)methyl]pyrimidin-4-one |
| SMILES | CCc1ccc(Cl)cc1Nc1nc(=O)c(F)cn1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H14ClF4N3O/c1-2-11-3-4-12(20)7-16(11)25-19-26-18(28)15(23)9-27(19)8-10-5-13(21)17(24)14(22)6-10/h3-7,9H,2,8H2,1H3,(H,25,26,28) |
| InChIKey | HMYHSMGMHFCIFU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|